| Identification | |
| Name: | Pentanoic-5,5,5-d3acid, 2-(propyl-3,3,3-d3)- (9CI) |
| Synonyms: | 5,5,5,5',5',5'-Hexadeuterovalproicacid |
| CAS: | 87745-18-4 |
| Molecular Formula: | C8H10 D6 O2 |
| Molecular Weight: | 150.25 |
| InChI: | InChI=1/C8H16O2/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10)/i1D3,2D3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 116.6°C |
| Boiling Point: | 220°C at 760 mmHg |
| Density: | 0.965g/cm3 |
| Refractive index: | 1.435 |
| Specification: | Colorless Liquid usageEng:Antiepileptic; increases levels of -aminobutyric acid(GABA) in the brain. Anticonvulsant that also has efficacy as a mood stabilizer in bipolar disorder |
| Flash Point: | 116.6°C |
| Storage Temperature: | Refrigerator |
| Usage: | Antiepileptic; increases levels of -aminobutyric acid(GABA) in the brain. Anticonvulsant that also has efficacy as a mood stabilizer in bipolar disorder |
| Safety Data | |
 |
|
