| Identification | |
| Name: | D-Mannose,3-deoxy-3-fluoro- |
| Synonyms: | 3-Deoxy-3-fluoro-D-mannose |
| CAS: | 87764-46-3 |
| Molecular Formula: | C6H11 F O5 |
| Molecular Weight: | 182.15 |
| InChI: | InChI=1/C6H11FO5/c7-5(3(10)1-8)6(12)4(11)2-9/h1,3-6,9-12H,2H2/t3-,4-,5-,6-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 152-154 |
| Flash Point: | 258.1°C |
| Boiling Point: | 503.2°C at 760 mmHg |
| Density: | 1.494g/cm3 |
| Refractive index: | 1.505 |
| Flash Point: | 258.1°C |
| Usage: | Shown to be metabolized in yeast |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
