| Identification | |
| Name: | 4-Quinolinecarboxamide,2-chloro-N-[2-(diethylamino)ethyl]- |
| Synonyms: | Cinchoninamide,2-chloro-N-(2-diethylaminoethyl)- (6CI) |
| CAS: | 87864-14-0 |
| Molecular Formula: | C16H20 Cl N3 O |
| Molecular Weight: | 305.8 |
| InChI: | InChI=1/C16H20ClN3O/c1-3-20(4-2)10-9-18-16(21)13-11-15(17)19-14-8-6-5-7-12(13)14/h5-8,11H,3-4,9-10H2,1-2H3,(H,18,21) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 238.3°C |
| Boiling Point: | 470.5°C at 760 mmHg |
| Density: | 1.181g/cm3 |
| Refractive index: | 1.591 |
| Specification: | Off-White Solid usageEng:Intermediate in the preparation of Dibucaine. |
| Flash Point: | 238.3°C |
| Storage Temperature: | Refrigerator |
| Usage: | Intermediate in the preparation of Dibucaine. |
| Safety Data | |
 |
|
