| Identification | |
| Name: | Prosta-5,9,12,14-tetraen-1-oicacid, 11-oxo-, (5Z,12E,14E)- |
| Synonyms: | 15-DPGJ2;15-Deoxy-D12,14-PGJ2;15-Deoxy-D12,14-prostaglandin;15-Deoxy-D12,14-prostaglandin J2;D12,14-15-Deoxy-PGJ2;D12,14-15-Deoxyprostaglandin J2;D12,14-PGJ 2; |
| CAS: | 87893-55-8 |
| Molecular Formula: | C20H28O3 |
| Molecular Weight: | 316.43452 |
| InChI: | InChI=1S/C20H28O3/c1-2-3-4-5-6-10-13-18-17(15-16-19(18)21)12-9-7-8-11-14-20(22)23/h6-7,9-10,13,15-17H,2-5,8,11-12,14H2,1H3,(H,22,23)/b9-7-,10-6+,18-13+/t17-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1231 |
| Density: | 1.066 g/cm3 |
| Water Solubility: | Soluble in ethanol (25 mg/ml) and DMSO (25 mg/ml) |
| Solubility: | Soluble in ethanol (25 mg/ml) and DMSO (25 mg/ml) |
| Appearance: | Neat Oil |
| Specification: | Safety Statements:16-26-29-33-36/37/39 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 29:Do not empty into drains 33:Take precautionary measures against static discharges 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Biological Activity: | Selective PPAR γ agonist that induces adipocyte differentiation in C3H10Y1/2 fibroblasts (EC 50 = 7 μ M). |
| Storage Temperature: | −20°C |
| Safety Data | |
| Hazard Symbols |
F: Flammable
Xi: Irritant
|
 |
|
