| Identification | |
| Name: | Benzene,1,2,3,4-tetrachloro-5-nitro- |
| Synonyms: | 1,2,3,4-Tetrachloro-5-nitrobenzene;1-Nitro-2,3,4,5-tetrachlorobenzene; 2,3,4,5-Tetrachloro-1-nitrobenzene; NSC5577; NSC 57752 |
| CAS: | 879-39-0 |
| EINECS: | 212-906-5 |
| Molecular Formula: | C6H Cl4 N O2 |
| Molecular Weight: | 260.89 |
| InChI: | InChI=1/C6HCl4NO2/c7-2-1-3(11(12)13)5(9)6(10)4(2)8/h1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 65°C |
| Flash Point: | 144.4°C |
| Boiling Point: | 315.2°C at 760 mmHg |
| Density: | 1.75g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.62 |
| Solubility: | 7.3 mg/L |
| Appearance: | Pale yellow to green crystalline solid. |
| Specification: |
2,3,4,5-Tetrachloronitrobenzene will behave as a weak oxidizer, and will react with strong reducing agents including hydrides, sulfides and nitrides. |
| Flash Point: | 144.4°C |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Usage: | In organic synthesis. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
