| Identification | |
| Name: | 2-Quinoxalinecarboxylic acid |
| Synonyms: | NSC86873; |
| CAS: | 879-65-2 |
| Molecular Formula: | C9H6N2O2 |
| Molecular Weight: | 174.16 |
| InChI: | InChI=1/C9H6N2O2/c12-9(13)8-5-10-6-3-1-2-4-7(6)11-8/h1-5H,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.421 g/cm3 |
| Appearance: | TAN POWDER. |
| Specification: | Yellowish-green crystalline powder Safety Statements:26-37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Storage Temperature: | 0-6°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
