Identification |
Name: | 2, 4, 6-Trichlorophenol |
Synonyms: | 2,4,6-Trichloro-2-hydroxybenzene; 2,4,6-TCP; 2,4,6-TRICHLOROPHENOL; DOWICIDE 2S; DOWICIDE 2S(R); PHENACHLOR; OMAL; TRICHLOROPHENOL(2,4,6-); 2,4,6-TRICHLORO PHENOL |
CAS: | 88-06-2 |
EINECS: | 201-795-9 |
Molecular Formula: | C6H3Cl3O |
Molecular Weight: | 197.45 |
InChI: | InChI=1/C6H3Cl3O/c7-3-1-4(8)6(10)5(9)2-3/h1-2,10H |
Molecular Structure: |
 |
Properties |
Transport: | UN 2020 |
Density: | 1.49 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.608 |
Water Solubility: | 0.8 g/L |
Solubility: | SOLVENT |
Appearance: | white to off-white crystalline solid |
Packinggroup: | III |
HS Code: | 29081000 |
Storage Temperature: | 0-6°C |
Color: | white to slightly brown |
Usage: | Herbicide, defoliant, fungicide former uses. |
Safety Data |
Hazard Symbols |
Xn:Harmful
N:Dangerousfortheenvironment
|
|
 |