| Identification | |
| Name: | 2-Ethylbutyric acid |
| Synonyms: | Pentane-3-carboxylic acid; Diethylacetic acid; 2-Ethylbutanoic Acid |
| CAS: | 88-09-5 |
| EINECS: | 201-796-4 |
| Molecular Formula: | C6H12O2 |
| Molecular Weight: | 116.16 |
| InChI: | InChI=1/C6H12O2/c1-3-5(4-2)6(7)8/h5H,3-4H2,1-2H3,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Density: | 0.924 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.412-1.414 |
| Solubility: | sparingly soluble miscible with the usual organic solvents |
| Appearance: | clear liquid |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29159080 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Usage: | Used in flavourings; as an intermediate for pharmaceuticals and dyestuffs; in the manufacture of esters and other chemicals. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
