| Identification | |
| Name: | Anthranilamide |
| Synonyms: | 2-Aminobenzamide, (Anthranilamide); ATA; Anthranilic acid amide; 2-Aminobenzamide; O-Aminobenzamide |
| CAS: | 88-68-6 |
| EINECS: | 201-851-2 |
| Molecular Formula: | C7H8N2O |
| Molecular Weight: | 136.15122 |
| InChI: | InChI=1S/C7H8N2O/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,8H2,(H2,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.233 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.633 |
| Water Solubility: | Soluble in hot water |
| Solubility: | Soluble in hot water |
| Appearance: | light brown to grey-brown crystal powder or flakes |
| Specification: |
?Anthranilamide (CAS NO.88-68-6) is also named as 2-Aminobenzamide ; 2-Aminobenzamide (VAN) ; 2-Carbamoylaniline ; 4-14-00-01010 (Beilstein Handbook Reference) ; AI3-28018 ; Anthranilamide ; Anthranilamide (VAN) ; Anthranilimidic acid ; Anthranilimidic acid (VAN) ; BRN 0508509 ; Benzamide, 2-amino- ; Benzamide, o-amino- ; Benzoic acid, 2-amino-, amide ; HSDB 5261 ; NSC 38768 ; o-Aminobenzamide ; o-Aminobenzamide (VAN)?.?Anthranilamide (CAS NO.88-68-6) is light brown to grey-brown crystal powder or flakes. It?is?toxic and?flammable. It will produce toxic nitrogen oxide fumes when buring. So the storage environment should be ventilate, low-temperature and dry. |
| HS Code: | 29242995 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | LEAFLETS FROM CHLOROFORM OR WATER |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
