| Identification | |
| Name: | 2-Isopropylphenol |
| Synonyms: | o-Cumenol; o-Hydroxycumene |
| CAS: | 88-69-7 |
| EINECS: | 201-852-8 |
| Molecular Formula: | C9H12O |
| Molecular Weight: | 136.19 |
| InChI: | InChI=1/C9H12O/c1-7(2)8-5-3-4-6-9(8)10/h3-7,10H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3145 |
| Density: | 1.012 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5255-1.5275 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble SOLVENT |
| Appearance: | clear to pale yellow liquid |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29071900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
