| Identification | |
| Name: | 2-Nitroaniline |
| Synonyms: | fast orange GR base; 1-Amino-2-nitrobenzene; o-Nitroaniline |
| CAS: | 88-74-4 |
| EINECS: | 201-855-4 |
| Molecular Formula: | C6H6N2O2 |
| Molecular Weight: | 138.12 |
| InChI: | InChI=1/C6H6N2O2/c7-5-3-1-2-4-6(5)8(9)10/h1-4H,7H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1661 |
| Density: | 1.442 |
| Stability: | Stable. Incompatible with acids, acid chlorides, acid anhydrides, strong oxidizing agents, chloroformates, hexanitroethane. |
| Refractive index: | 1.5362 (100 C) |
| Solubility: | 1.1 g/L (20 oC) in water |
| Appearance: | yellow orange crystals. |
| Specification: |
Handling: Do not get in eyes, on skin, or on clothing. Do not breathe vapor. Wash thoroughly after handling. Remove contaminated clothing and wash before reuse. Use only with adequate ventilation or respiratory protection. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29214210 |
| Color: | Yellow-orange crystals from boiling water Orange-red needles |
| Usage: | Chemical intermediate for ci pigment yellow 5, orange 2, yellow 7, vat red 15, vat orange 7, ci pigment orange 43, vat red 14, disperse yellow 10. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
