| Identification | |
| Name: | 2-Nitrophenol |
| Synonyms: | o-Nitrophenol; ; 2-Hydroxynitrobenzene |
| CAS: | 88-75-5 |
| EINECS: | 201-857-5 |
| Molecular Formula: | C6H5NO3 |
| Molecular Weight: | 139.11 |
| InChI: | InChI=1/C6H5NO3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1663 |
| Density: | 1.495 |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. |
| Refractive index: | 1.5723 (50 C) |
| Solubility: | Slightly soluble (0.21 g/100ml) |
| Appearance: | yellow to brown crystals |
| Packinggroup: | III |
| HS Code: | 29089000 |
| Storage Temperature: | Store in dark! |
| Sensitive: | Light Sensitive |
| Color: | Light yellow needles or prisms MONOCLINIC |
| Usage: | Acid-base indicator. Corrosion inhibitor for aluminium-copper alloy. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
