| Identification | |
| Name: | Benzoic acid,2,5-dichloro-3-nitro- |
| Synonyms: | 2,5-Dichloro-3-nitrobenzoicacid; 3-Nitro-2,5-dichlorobenzoic acid; Dinoben |
| CAS: | 88-86-8 |
| EINECS: | 201-862-2 |
| Molecular Formula: | C7H3 Cl2 N O4 |
| Molecular Weight: | 236.01 |
| InChI: | InChI=1/C7H3Cl2NO4/c8-3-1-4(7(11)12)6(9)5(2-3)10(13)14/h1-2H,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.713 g/cm3 |
| Refractive index: | 1.638 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
