Identification |
Name: | 2-Propenoic acid,3-(4-nitrophenyl)-, (2E)- |
Synonyms: | 2-Propenoicacid, 3-(4-nitrophenyl)-, (E)-; Cinnamic acid, p-nitro-, (E)- (8CI);(2E)-3-(4-Nitrophenyl)-2-propenoic acid; (E)-4-Nitrocinnamic acid;(E)-p-Nitrocinnamic acid; trans-4-Nitrocinnamic acid; trans-p-Nitrocinnamicacid |
CAS: | 882-06-4 |
EINECS: | 212-924-3 |
Molecular Formula: | C9H7 N O4 |
Molecular Weight: | 193.15 |
InChI: | InChI=1/C9H7NO4/c11-9(12)6-3-7-1-4-8(5-2-7)10(13)14/h1-6H,(H,11,12)/b6-3+ |
Molecular Structure: |
|
Properties |
Density: | 1.411 |
Specification: | Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
|