Identification |
Name: | Hydrazine,(2,4-dinitrophenyl-1,2,3,4,5,6-13C6)- |
Synonyms: | Hydrazine,(2,4-dinitrophenyl-13C6)- (9CI) |
CAS: | 882513-61-3 |
Molecular Formula: | C6H6 N4 O4 |
Molecular Weight: | 0 |
InChI: | InChI=1/C6H6N4O4/c7-8-5-2-1-4(9(11)12)3-6(5)10(13)14/h1-3,8H,7H2/i1+1,2+1,3+1,4+1,5+1,6+1 |
Molecular Structure: |
 |
Properties |
Density: | 1.655g/cm3 |
Refractive index: | 1.731 |
Usage: | A novel isotope-labeled dinitrophenylhydrazines (DNPHs) and methods for their use in detecting and/or quantifying carbonyl groups in proteins and other analytes |
Safety Data |
|
 |