| Identification |
| Name: | 2H-1-Benzopyran-2-one,4-(bromomethyl)-6,7-dimethoxy- |
| Synonyms: | 4-Bromomethyl-6,7-dimethoxycoumarin; |
| CAS: | 88404-25-5 |
| Molecular Formula: | C12H11BrO4 |
| Molecular Weight: | 299.12 |
| InChI: | InChI=1/C12H11BrO4/c1-15-10-4-8-7(6-13)3-12(14)17-9(8)5-11(10)16-2/h3-5H,6H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 1759 |
| Melting Point: | 212-216 °C(lit.)
|
| Flash Point: | 206°C |
| Boiling Point: | 417.1°C at 760 mmHg |
| Density: | 1.515g/cm3 |
| Refractive index: | 1.578 |
| Appearance: | light greenish-yellow powder |
| Packinggroup: | III |
| Flash Point: | 206°C |
| Storage Temperature: | Refrigerator |
| Usage: | A fluorescent labeling reagent for the reversed-phase HPLC separation and detection of carboxylic acids |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
C: Corrosive
|
| |
 |
