| Identification |
| Name: | 2,4,5-Trifluorobenzoyl chloride |
| Synonyms: | AKOS 91963;2,4,5-TRIFLUOROBENZOYL CHLORIDE;TIMTEC-BB SBB006657;Benzoyl chloride, 2,4,5-trifluoro- (9CI);2,4,5-Trifluorobenzoyl;2,4,5-Trifluorobenzoyl chloride 99%;2,4,5-Trifluorobenzoylchloride99% |
| CAS: | 88419-56-1 |
| Molecular Formula: | C7H2ClF3O |
| Molecular Weight: | 194.54 |
| InChI: | InChI=1/C7H2ClF3O/c8-7(12)3-1-5(10)6(11)2-4(3)9/h1-2H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 |
| Density: | 1.52 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.497-1.499 |
| Solubility: | Insoluble |
| Appearance: | clear colorless liquid |
| Packinggroup: | II |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. Store protected from moisture. |
| Sensitive: | Lachrymatory |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
