3-Pyridinecarboxylicacid, 5-fluoro-2-methoxy- (884494-82-0)

The cas register number of 5-Fluoro-2-methoxynicotinic acid is 884494-82-0. It also can be called as 3-Pyridinecarboxylicacid, 5-fluoro-2-methoxy- and the Systematic name about this chemical is 5-fluoro-2-methoxy-pyridine-3-carboxylic acid. It belongs to the following product categories, such as Pyridine, Niacin and so on.

Physical properties about 5-Fluoro-2-methoxynicotinic acid are: (1)ACD/LogP: 1.43; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1; (5)ACD/KOC (pH 7.4): 1; (6)#H bond acceptors: 4; (7)#H bond donors: 1; (8)#Freely Rotating Bonds: 2; (9)Polar Surface Area: 59.42 Å²; (10)Index of Refraction: 1.527; (11)Molar Refractivity: 37.946 cm³; (12)Molar Volume: 123.399 cm³; (13)Polarizability: 15.043x10^-24cm³; (14)Surface Tension: 49.519 dyne/cm; (15)Enthalpy of Vaporization: 55.203 kJ/mol; (16)Vapour Pressure: 0.001 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: COc1c(cc(cn1)F)C(=O)O
(2)InChI: InChI=1/C7H6FNO3/c1-12-6-5(7(10)11)2-4(8)3-9-6/h2-3H,1H3,(H,10,11)
(3)InChIKey: WMTDYCWMCDHQHR-UHFFFAOYAR
(4)Std. InChI: InChI=1S/C7H6FNO3/c1-12-6-5(7(10)11)2-4(8)3-9-6/h2-3H,1H3,(H,10,11)
(5)Std. InChIKey: WMTDYCWMCDHQHR-UHFFFAOYSA-N