| Identification | |
| Name: | 2(1H)-Pyridinone,3-bromo-5-fluoro- |
| Synonyms: | 3-Bromo-5-fluoro-2-hydroxypyrdine; |
| CAS: | 884494-94-4 |
| Molecular Formula: | C5H3BrFNO |
| Molecular Weight: | 191.9858232 |
| InChI: | InChI=1/C5H3BrFNO/c6-4-1-3(7)2-8-5(4)9/h1-2H,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.891 g/cm3 |
| Refractive index: | 1.582 |
| Specification: |
The CAS register number of 3-Bromo-5-fluoro-2-hydroxypyrdine is 884494-94-4. It also can be called as 2(1H)-Pyridinone,3-bromo-5-fluoro- and the systematic name about this chemical is 3-bromo-5-fluoro-pyridin-2-ol. It belongs to the following product categories, such as blocks, Heterocycles, Pyridines and so on. Physical properties about 3-Bromo-5-fluoro-2-hydroxypyrdine are: (1)ACD/LogP: 0.87; (2)ACD/LogD (pH 5.5): 0.84; (3)ACD/LogD (pH 7.4): 0.4; (4)#H bond acceptors: 2; (5)#H bond donors: 1; (6)Polar Surface Area: 33.12Å2; (7)Index of Refraction: 1.582; (8)Molar Refractivity: 33.9 cm3; (9)Molar Volume: 101.4 cm3; (10)Polarizability: 13.44x10-24cm3; (11)Surface Tension: 53.1 dyne/cm; (12)Enthalpy of Vaporization: 52.91 kJ/mol; (13)Boiling Point: 270.4 °C at 760 mmHg; (14)Vapour Pressure: 0.00412 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
