| Identification | |
| Name: | 3-Pyridinecarboxaldehyde,6-chloro-2-methyl- |
| Synonyms: | 2-Methyl-6-chloropyridine-3-carboxaldehyde;6-Chloro-2-methyl-pyridine-3-carboxaldehyde;6-Chloro-2-methylnicotinaldehyde; |
| CAS: | 884495-36-7 |
| Molecular Formula: | C7H6ClNO |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C7H6ClNO/c1-5-6(4-10)2-3-7(8)9-5/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.27 g/cm3 |
| Refractive index: | 1.581 |
| Specification: |
The CAS register number of 2-Methyl-6-chloropyridine-3-carboxaldehyde is 884495-36-7. It also can be called as 6-Chloro-3-formyl-2-picoline and the systematic name about this chemical is 6-chloro-2-methyl-pyridine-3-carbaldehyde. It belongs to the Pyridine. Physical properties about 2-Methyl-6-chloropyridine-3-carboxaldehyde are: (1)ACD/LogP: 1.27; (2)ACD/LogD (pH 5.5): 1.273; (3)ACD/LogD (pH 7.4): 1.273; (4)ACD/BCF (pH 5.5): 5.467; (5)ACD/BCF (pH 7.4): 5.467; (6)ACD/KOC (pH 5.5): 117.414; (7)ACD/KOC (pH 7.4): 117.414; (8)#H bond acceptors: 2; (9)#Freely Rotating Bonds: 1; (10)Polar Surface Area: 29.96Å2; (11)Index of Refraction: 1.581; (12)Molar Refractivity: 40.817 cm3; (13)Molar Volume: 122.549 cm3; (14)Polarizability: 16.181x10-24cm3; (15)Surface Tension: 46.486 dyne/cm; (16)Enthalpy of Vaporization: 49.425 kJ/mol; (17)Boiling Point: 256.728 °C at 760 mmHg; (18)Vapour Pressure: 0.015 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
