| Identification | |
| Name: | 3-Pyridazinamine,6-bromo- |
| Synonyms: | Pyridazine,3-amino-6-bromo- (6CI,7CI); 3-Amino-6-bromopyridazine; 6-Bromo-3-pyridazinamine |
| CAS: | 88497-27-2 |
| Molecular Formula: | C4H4 Br N3 |
| Molecular Weight: | 174 |
| InChI: | InChI=1/C4H4BrN3/c5-3-1-2-4(6)8-7-3/h1-2H,(H2,6,8) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.844g/cm3 |
| Refractive index: | 1.648 |
| Specification: | Safety Statements:22-26-36/37/39 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
 |
|
