| Identification | |
| Name: | [1,1'-Biphenyl]-4-ol,3-nitro- |
| Synonyms: | 4-Biphenylol,3-nitro- (8CI); Phenol, 2-nitro-4-phenyl- (6CI,7CI); 2-Nitro-4-phenylphenol;2-Nitro-p-phenylphenol; 3-Nitro-4-biphenylol; 3-Nitro-4-hydroxybiphenyl;4-Hydroxy-3-nitrobiphenyl; 4-Phenyl-2-nitrophenol; NSC 95810 |
| CAS: | 885-82-5 |
| EINECS: | 212-946-3 |
| Molecular Formula: | C12H9 N O3 |
| Molecular Weight: | 215.2 |
| InChI: | InChI=1/C12H9NO3/c14-12-7-6-10(8-11(12)13(15)16)9-4-2-1-3-5-9/h1-8,14H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 69-70°C |
| Flash Point: | 145.1°C |
| Boiling Point: | 338.5°C at 760 mmHg |
| Density: | 1.304g/cm3 |
| Refractive index: | 1.637 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 145.1°C |
| Safety Data | |
 |
|
