| Identification | |
| Name: | Phenol,4-(trans-4-butylcyclohexyl)- |
| Synonyms: | Phenol,4-(4-butylcyclohexyl)-, trans-;p-(trans-4-Butylcyclohexyl)phenol; |
| CAS: | 88581-00-4 |
| Molecular Formula: | C16H24O |
| Molecular Weight: | 232.36 |
| InChI: | InChI=1/C16H24O/c1-2-3-4-13-5-7-14(8-6-13)15-9-11-16(17)12-10-15/h9-14,17H,2-8H2,1H3/t13-,14- |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.969 g/cm3 |
| Refractive index: | 1.517 |
| Specification: |
4-(trans-4-Butylcyclohexyl)phenol , its cas register number is 88581-00-4. It also can be called P-(Trans-4-butylcyclohexyl)phenol ; 4-(Trans-4-n-butylcyclohexyl)phenol ; 4-Butyl-cyclohexyl phenol ; 4-(Trans-4-N-Butylcyclohexyl) ; 4-(Trans-4-n-butylcyclohexyl)phenol (4pco) ; trans-4-(4-Butylcyclohexyl)-phenol ; 4-(trans-4-Butylcyclohexyl)phenol . 4-(trans-4-Butylcyclohexyl)phenol (CAS NO.88581-00-4) has been used for intermediate of liquid crystals. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
 |
|
