| Identification | |
| Name: | Imidazo[1,2-a]pyridine-6-carboxylicacid, 3-bromo- |
| Synonyms: | 3-BROMOIMIDAZO[1,2-A]PYRIDINE-6-CARBOXYLIC ACID |
| CAS: | 886362-00-1 |
| Molecular Formula: | C8H5BrN2O2 |
| Molecular Weight: | 241.04 |
| InChI: | InChI=1/C8H5BrN2O2/c9-6-3-10-7-2-1-5(8(12)13)4-11(6)7/h1-4H,(H,12,13) |
| Molecular Structure: | ![(C8H5BrN2O2) 3-BROMOIMIDAZO[1,2-A]PYRIDINE-6-CARBOXYLIC ACID](https://img1.guidechem.com/chem/e/dict/134/886362-00-1.jpg) |
| Properties | |
| Density: | 1.89 g/cm3 |
| Refractive index: | 1.728 |
| Specification: |
The 3-Bromoimidazo[1,2-a]pyridine-6-carboxylic acid, with its CAS registry number 886362-00-1, has the chemical formula of C8H5BrN2O2. And its product categories are including chiral chemicals. The characteristics of this chemical are as follows: (1)ACD/LogP: 2.02; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 4; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 1; (10)Polar Surface Area: 43.6 ; (11)Index of Refraction: 1.728; (12)Molar Refractivity: 50.58 cm3; (13)Molar Volume: 126.9 cm3; (14)Polarizability: 20.05×10-24 cm3. In addition, you could convert the following datas into the molecular structure: |
| Safety Data | |
 |
|
