| Identification | |
| Name: | 3-Bromobenzyl mercaptan |
| Synonyms: | 3-BROMOBENZYLMERCAPTAN |
| CAS: | 886497-84-3 |
| Molecular Formula: | C7H7BrS |
| Molecular Weight: | 203.1 |
| InChI: | InChI=1/C7H7BrS/c8-7-3-1-2-6(4-7)5-9/h1-4,9H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2810 |
| Flash Point: | 113.9°C |
| Boiling Point: | 264.7°C at 760 mmHg |
| Density: | 1.493g/cm3 |
| Refractive index: | 1.603 |
| Appearance: | colorless to lark liquid appearing to be rotten |
| Packinggroup: | III |
| Flash Point: | 113.9°C |
| Sensitive: | Air Sensitive |
| Safety Data | |
 |
|
