| Identification | |
| Name: | (S)-Methyl 2-(pyrrolidin-2-yl)acetate |
| Synonyms: | methyl (2S)-pyrrolidin-2-ylacetate;2-pyrrolidineacetic acid, methyl ester, (2S)-; |
| CAS: | 88790-37-8 |
| Molecular Formula: | C7H13NO2 |
| Molecular Weight: | 143.18 |
| InChI: | InChI=1/C7H13NO2/c1-10-7(9)5-6-3-2-4-8-6/h6,8H,2-5H2,1H3/t6-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 68.84°C |
| Boiling Point: | 190.215°C at 760 mmHg |
| Density: | 1.006g/cm3 |
| Refractive index: | 1.44 |
| Specification: |
The (S)-Methyl 2-(pyrrolidin-2-yl)acetate with the cas number 88790-37-8, is also called methyl (2S)-pyrrolidin-2-ylacetate . The properties of this chemical are: (1)#H bond acceptors: 3 ; (2)#H bond donors: 1 ; (3)#Freely Rotating Bonds: 3 ; (4)Polar Surface Area: 38.33Å2 ; (5)Index of Refraction: 1.44 ; (6)Molar Refractivity: 37.529 cm3 ; (7)Molar Volume: 142.31 cm3 ; (8)Polarizability: 14.878×10-24cm3 ; (9)Surface Tension: 33.208 dyne/cm ; (10)Enthalpy of Vaporization: 42.642 kJ/mol ; (11)Vapour Pressure: 0.548 mmHg at 25°C.C7H13NO2 You can still convert the following datas into molecular structure : |
| Flash Point: | 68.84°C |
| Safety Data | |
 |
|
