| Identification | |
| Name: | Guanosine,2'-deoxy-7,8-dihydro-8-oxo- |
| Synonyms: | 7,8-Dihydro-8-oxo-2'-deoxyguanosine;7,8-Dihydro-8-oxodeoxyguanosine; 8-Hydroxy-2'-deoxyguanosine;8-Hydroxydeoxyguanosine; 8-Oxo-2'-deoxyguanosine;8-Oxo-7,8-dihydro-2'-deoxyguanosine; 8-Oxo-7,8-dihydrodeoxyguanosine; 8-Oxo-dG |
| CAS: | 88847-89-6 |
| Molecular Formula: | C10H13 N5 O5 |
| Molecular Weight: | 283.24072 |
| InChI: | InChI=1S/C10H13N5O5/c11-9-13-7-6(8(18)14-9)12-10(19)15(7)5-1-3(17)4(2-16)20-5/h3-5,16-17H,1-2H2,(H,12,19)(H3,11,13,14,18)/t3-,4+,5+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 2.25 g/cm3 |
| Refractive index: | 1.955 |
| Water Solubility: | Soluble in water (15mg/ml). |
| Solubility: | Soluble in water (15mg/ml). |
| Appearance: | White solid. |
| Specification: |
8-Hydroxydeoxyguanosine ,its CAS NO. is 88847-89-6,the synonyms is 7,8-Dihydro-2'-deoxy-8-oxo-guanosin ; 7,8-Dihydro-2'deoxy-8-oxoguanosine ; 8-Hydroxydeoxyguanosine ; 8-Oxo-7-hydrodeoxyguanosine ; 8-Oxo-2'-deoxyguanosine ; 8-Hydroxy-2'-deoxyguanosine ; 8-Oxo-7,8-dihydro-2'-deoxyguanosine ; 8-Oxo-7,8-dihydrodeoxyguanosinexyguanosine ; 8-Oxo-7,8-dihydrodeoxyguanosine . |
| Storage Temperature: | 2-8°C |
| Usage: |
A marker compound indicative of DNA damage associated with mutagenesis and carcinogenesis. Can induce differentiation of Friend murine erythroleukemia cells in vitro. |
| Safety Data | |
 |
|
