| Identification | |
| Name: | 2,4-Imidazolidinedione,5-phenyl- |
| Synonyms: | Hydantoin,5-phenyl- (6CI,7CI,8CI);5-Phenyl-2,4-imidazolidinedione;5-Phenylhydantoin;5-Phenylimidazoline-2,4-dione;DL-5-Phenylhydantoin;NSC 27302;NSC 40885;NSC51847;Phenylhydantoin; |
| CAS: | 89-24-7 |
| EINECS: | 201-890-5 |
| Molecular Formula: | C9H8 N2 O2 |
| Molecular Weight: | 176.17 |
| InChI: | InChI=1/C9H8N2O2/c12-8-7(10-9(13)11-8)6-4-2-1-3-5-6/h1-5,7H,(H2,10,11,12,13) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 182°C |
| Density: | 1.276g/cm3 |
| Refractive index: | 1.569 |
| Specification: |
5-Phenylhydantoin , its cas register number is 89-24-7. It also can be called Phenylhydantoin ; 2,4-Imidazolidinedione, 5-phenyl- ; Hydantoin, 5-phenyl- (8CI) .It is a white solid. |
| Storage Temperature: | Refrigerator |
| Usage: | A metabolite of Mephenytoin |
| Safety Data | |
 |
|
