| Identification | |
| Name: | 2,4-Dinitrophenyl-dimethyl-dithiocarbamate |
| Synonyms: | Carbamodithioic acid, N,N-dimethyl-, 2,4-dinitrophenyl ester;2,4-Dinitrophenyl-dimethyl-dithiocarbamate;4-06-00-01760 (Beilstein Handbook Reference);AI3-28653;BRN 2475355;NSC 11461;USAF SN-31;2,4-Dinitrophenyl dimethyldithiocarbamate;Carbamic acid, dimethyldithio-, 2,4-dinitrophenyl ester;Carbamodithioic acid, dimethyl-, 2,4-dinitrophenyl ester;2,4-dinitrophenyl dimethylcarbamodithioate |
| CAS: | 89-37-2 |
| EINECS: | 201-902-9 |
| Molecular Formula: | C9H9N3O4S2 |
| Molecular Weight: | 287.3155 |
| InChI: | InChI=1/C9H9N3O4S2/c1-10(2)9(17)18-8-4-3-6(11(13)14)5-7(8)12(15)16/h3-5H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 205.9°C |
| Boiling Point: | 416.9°C at 760 mmHg |
| Density: | 1.52g/cm3 |
| Refractive index: | 1.684 |
| Specification: |
2,4-Dinitrophenyl-dimethyl-dithiocarbamate ,its cas register number is 89-37-2. It also can be called Carbamodithioic acid, dimethyl-, 2,4-dinitrophenyl ester ; and Carbamodithioic acid, N,N-dimethyl-, 2,4-dinitrophenyl ester . |
| Report: |
2,4-Dinitrophenyl-dimethyl-dithiocarbamate (CAS NO.89-37-2) has been reported in EPA TSCA Inventory. |
| Flash Point: | 205.9°C |
| Safety Data | |
 |
|
