| Identification | |
| Name: | neoagarohexaitol |
| Synonyms: | - |
| CAS: | 89-59-8 |
| EINECS: | 201-921-2 |
| Molecular Formula: | C7H6ClNO2 |
| Molecular Weight: | 171.58 |
| InChI: | InChI=1/C7H6ClNO2/c1-5-2-3-6(8)4-7(5)9(10)11/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2433/3457 |
| Density: | 1.324 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.57 |
| Solubility: | 109 mg/L (20 oC) |
| Appearance: | acicular crystal |
| Packinggroup: | III |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
