| Identification | |
| Name: | 4-Chloro-2-nitrophenol |
| Synonyms: | o-nitro-p-chorophenol; 2-nitro-4-chlorophenol |
| CAS: | 89-64-5 |
| EINECS: | 201-927-5 |
| Molecular Formula: | C6H4ClNO3 |
| Molecular Weight: | 173.56 |
| InChI: | InChI=1/C6H4ClNO3/c7-4-1-2-6(9)5(3-4)8(10)11/h1-3,9H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Flash Point: | 100.4°C |
| Boiling Point: | 242.5°C at 760 mmHg |
| Density: | 1.554 g/cm3 |
| Solubility: | insoluble in water |
| Appearance: | yellow powder |
| Specification: |
Phenol,4-chloro-2-nitro- with cas registry number of 89-64-5 is also called 4-Chloro-2-nitrophenol ; 2-Nitro-4-chlorophenol ; AI3-28527 ; NSC 520345 . |
| Packinggroup: | III |
| Flash Point: | 100.4°C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
