| Identification |
| Name: | Ethanone,1-(2,4-dimethylphenyl)- |
| Synonyms: | Acetophenone,2,4-dimethyl- (4CI);Acetophenone, 2',4'-dimethyl- (6CI,7CI,8CI);1-(2,4-Dimethylphenyl)ethanone;2,4-Dimethylacetophenone;2',4'-Dimethylacetophenone;NSC 15333; |
| CAS: | 89-74-7 |
| EINECS: | 201-935-9 |
| Molecular Formula: | C10H12O |
| Molecular Weight: | 148.2 |
| InChI: | InChI=1/C10H12O/c1-7-4-5-10(9(3)11)8(2)6-7/h4-6H,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.997 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.5336-1.5356 |
| Water Solubility: | insoluble in water; soluble in organic solvents, oils |
| Solubility: | insoluble in water; soluble in organic solvents, oils |
| Appearance: | colourless to slightly yellow oily liquid with a sweet, floral, woody, minty odour |
| Storage Temperature: | Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
