| Identification | |
| Name: | 2',4'-Dihydroxyacetophenone |
| Synonyms: | 4-Acetylresorcinol;Resacetophenone;2,4-Dihydroxyacetophenone; |
| CAS: | 89-84-9 |
| EINECS: | 201-945-3 |
| Molecular Formula: | C8H8O3 |
| Molecular Weight: | 152.15 |
| InChI: | InChI=1/C8H8O3/c1-5(9)7-3-2-6(10)4-8(7)11/h2-4,10-11H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.18 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.56467 (141.1 C) |
| Solubility: | Slightly soluble |
| Appearance: | yellow to brown crystalline powder |
| Specification: |
?2,4-Dihydroxyacetophenone (CAS NO.89-84-9) is also named as 1-(2,4-Dihydroxyphenyl)ethanone ; 2,4-Dihydroxyacetophenone ; 4-08-00-01792 (Beilstein Handbook Reference) ; 4-Acetylresorcinol ; AI3-00866 ; BRN 1282505 ; NSC 10883 ; Resacetophenone ; Resoacetophenone ; Resorcinol, 4-acetyl- ; UNII-UC3V356VZC?.?2,4-Dihydroxyacetophenone (CAS NO.89-84-9) is yellow-brown to reddish-brown fine cryst. It is soluble in hot alcohol, pyridine, and glacial acetic acid, almost insoluble in ether, benzene and chloroform. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29145000 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Moisture Sensitive |
| Usage: | Reagent for iron as a 10% alcoholic solution. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
