| Identification | |
| Name: | Benzenemethanol,2-methyl- |
| Synonyms: | Benzylalcohol, o-methyl- (8CI);(2-Methylphenyl)methanol;(2-Tolyl)methanol;2-Methylbenzenemethanol;NSC 91;o-Methylbenzylalcohol;o-Tolualcohol;o-Tolyl alcohol;o-Tolylmethanol;a-Hydroxy-o-xylene; |
| CAS: | 89-95-2 |
| EINECS: | 201-954-2 |
| Molecular Formula: | C8H10O |
| Molecular Weight: | 122.17 |
| InChI: | InChI=1/C8H10O/c1-7-4-2-3-5-8(7)6-9/h2-5,9H,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.08 g/cm3 |
| Stability: | No data. |
| Refractive index: | n20/D 1.5408(lit.) |
| Solubility: | methanol: 0.1 g/mL, clear |
| Appearance: | White solid. |
| Specification: |
2-Methylbenzyl Alcohol (89-95-2),which also can be called for O-Tolylcarbinol ; O-Methylbenyl Alcohol ; Rarechem AL BD 0047 ; 2-Tolyl Carbinol ; 2-Methylbenzyl Alcohol ; Alpha-Hydroxy-O-Xylene ; 2-Methylbenzyl Alcohol,98% ; O-Tolylmethanol . 2-Methylbenzyl Alcohol (89-95-2) is solid and its colour is white.This chemical should be stored in a cool, dry place.Store in a tightly closed container.When handling with 2-Methylbenzyl Alcohol (89-95-2),avoid breathing dust, vapor, mist, or gas. Avoid contact with skin and eyes.After decomposition,it turned into Carbon Monoxide and Carbon Dioxide. |
| HS Code: | 29062900 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
