| Identification |
| Name: | Benzenemethanamine,2-chloro- |
| Synonyms: | 2-Chlorobenzenemethanamine;1-Aminomethyl-2-chlorobenzene; |
| CAS: | 89-97-4 |
| EINECS: | 201-955-8 |
| Molecular Formula: | C7H8ClN |
| Molecular Weight: | 141.6 |
| InChI: | InChI=1/C7H8ClN/c8-7-4-2-1-3-6(7)5-9/h1-4H,5,9H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 230kg |
| Density: | 1.17 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. Air sensitive |
| Refractive index: | 1.562-1.564 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | Clear liquid |
| Packinggroup: | III |
| HS Code: | 29214980 |
| Storage Temperature: | Keep away from sources of ignition. Keep container closed when not in use. Corrosives area. Do not expose to air. Store under an inert atmosphere. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
