| Identification |
| Name: | 1H-Imidazole,2-(2-benzofuranyl)-4,5-dihydro-, hydrochloride (1:1) |
| Synonyms: | 1H-Imidazole,2-(2-benzofuranyl)-4,5-dihydro-, monohydrochloride (9CI);2-(Benzofuran-2-yl)-2-imidazolinehydrochloride; |
| CAS: | 89196-95-2 |
| Molecular Formula: | C11H11ClN2O |
| Molecular Weight: | 222.67 |
| InChI: | InChI=1/C11H10N2O.ClH/c1-2-4-9-8(3-1)7-10(14-9)11-12-5-6-13-11;/h1-4,7H,5-6H2,(H,12,13);1H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 164.4°C |
| Boiling Point: | 348.1°C at 760 mmHg |
| Biological Activity: | High affinity I 2 ligand (K i = 9.8 nM). Putative I 2 agonist; potentiates morphine antinociception. Produces ipsiversive rotational behavior in rats with a full 6-OHDA lesion of the nigrostriatal tract. |
| Flash Point: | 164.4°C |
| Storage Temperature: | Desiccate at RT |
| Safety Data |
| |
 |
