| Identification | |
| Name: | Piperazine,1-[(4-chlorophenyl)phenylmethyl]-, hydrochloride (1:1) |
| Synonyms: | Piperazine,1-(p-chloro-a-phenylbenzyl)-,monohydrochloride (8CI); Piperazine, 1-[(4-chlorophenyl)phenylmethyl]-,monohydrochloride (9CI) |
| CAS: | 894-56-4 |
| EINECS: | 212-972-5 |
| Molecular Formula: | C17H19 Cl N2 . Cl H |
| Molecular Weight: | 337.32 |
| InChI: | InChI=1/C18H21ClN2.ClH/c1-20-11-13-21(14-12-20)18(15-5-3-2-4-6-15)16-7-9-17(19)10-8-16;/h2-10,18H,11-14H2,1H3;1H/t18-;/m1./s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 209.3°C |
| Boiling Point: | 422.5°C at 760 mmHg |
| Specification: |
1-((4-Chlorophenyl)benzyl)piperazinium chloride , its cas register number is 894-56-4. It also can be called Piperazine, 1-((4-chlorophenyl)phenylmethyl)-, hydrochloride ; Norchlorcyclizine HCl ; and Norchlorcyclizine hydrochloride . |
| Flash Point: | 209.3°C |
| Safety Data | |
 |
|
