Identification |
Name: | 2,4-Imidazolidinedione,1,3-dichloro-5-ethyl-5-methyl- |
Synonyms: | Hydantoin,1,3-dichloro-5-ethyl-5-methyl- (6CI,7CI);1,3-Dichloro-5-ethyl-5-methylhydantoin; DCMEH |
CAS: | 89415-87-2 |
EINECS: | 401-570-7 |
Molecular Formula: | C6H8 Cl2 N2 O2 |
Molecular Weight: | 211.05 |
InChI: | InChI=1/C6H8Cl2N2O2/c1-3-6(2)4(11)9(7)5(12)10(6)8/h3H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Transport: | 1479 |
Melting Point: | 54-57ºC |
Density: | 1.5 g/cm3 |
Refractive index: | 1.56 |
Appearance: | White crystal powder,faint odor of irritation |
Packinggroup: | II |
Safety Data |
Hazard Symbols |
O: Oxidizing agent
T: Toxic
N: Dangerous for the environment
|
|
 |