Identification |
Name: | Propanamide,2-hydroxy-N-[2-[(8S)-1,6,7,8-tetrahydro-2H-indeno[5,4-b]furan-8-yl]ethyl]- |
Synonyms: | 2-Hydroxy-N-[2-[(8S)-1,6,7,8-tetrahydro-2H-cyclopenta[e]benzofuran-8-yl]ethyl]-propanamide;Ramelteon Metabolite M-II;Ramelteon Metabolite M-II (mixture of R and S at the hydroxy position) |
CAS: | 896736-21-3 |
Molecular Formula: | C16H21 N O3 |
Molecular Weight: | 0 |
InChI: | InChI=1/C16H21NO3/c1-10(18)16(19)17-8-6-12-3-2-11-4-5-14-13(15(11)12)7-9-20-14/h4-5,10,12,18H,2-3,6-9H2,1H3,(H,17,19)/t10?,12-/m0/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 253.271°C |
Boiling Point: | 495.171°C at 760 mmHg |
Density: | 1.199g/cm3 |
Refractive index: | 1.576 |
Flash Point: | 253.271°C |
Storage Temperature: | Refrigerator |
Usage: | The major metabolite of Ramelteon in serum (M-II) |
Safety Data |
|
|