| Identification | |
| Name: | Aceclofenac |
| Synonyms: | Aceclofenac [INN:BAN];Glycolic acid, (o-(2,6-dichloroanilino)phenyl)acetate (ester);Benzeneacetic acid, 2-((2,6-dichlorophenyl)amino)-, carboxymethyl ester;Aceclofenacum;Aceclofenaco;2-(o-(2,6-Dichloranilino)phenylacetoxy)essigsaeure; |
| CAS: | 89796-99-6 |
| Molecular Formula: | C16H13Cl2NO4 |
| Molecular Weight: | 354.19 |
| InChI: | InChI=1/C16H13Cl2NO4/c17-11-5-3-6-12(18)16(11)19-13-7-2-1-4-10(13)8-15(22)23-9-14(20)21/h1-7,19H,8-9H2,(H,20,21) |
| Molecular Structure: | ![(C16H13Cl2NO4) Aceclofenac [INN:BAN];Glycolic acid, (o-(2,6-dichloroanilino)phenyl)acetate (ester);Benzeneacetic ac...](https://img.guidechem.com/casimg/89796-99-6.gif) |
| Properties | |
| Density: | 1.455 g/cm3 |
| Refractive index: | 1.639 |
| Appearance: | white or off-white crystalline powder |
| Specification: |
?Aceclofenac , its cas register number is 89796-99-6. It also can be called Aceclofenac [INN:BAN] ; 2-((2,6-Dichlorophenyl)amino)benzeneacetic acid carboxymethyl ester ; 2-(o-(2,6-Dichloranilino)phenylacetoxy)essigsaeure ; Aceclofenaco ; Aceclofenacum ; Glycolic acid, (o-(2,6-dichloroanilino)phenyl)acetate (ester) ; Benzeneacetic acid, 2-((2,6-dichlorophenyl)amino)-, carboxymethyl ester ; Glycolic acid, (o-(2,6-dichloroanilino)phenyl)acetate (ester) . It is a white crystalline solid. Also it is a non-steroidal anti-inflammatory drug and it is manufactured by Intas Biopharmaceuticals. |
| Usage: | Anti-inflammatory; analgesic |
| Safety Data | |
 |
|
