| Identification | |
| Name: | Naphthalene,1-bromo- |
| Synonyms: | 1-Naphthyl bromide;NSC 6551;Naphthalen-1-yl bromide;a-Bromonaphthalene;a-Naphthyl bromide; |
| CAS: | 90-11-9 |
| EINECS: | 201-965-2 |
| Molecular Formula: | C10H7Br |
| Molecular Weight: | 207.07 |
| InChI: | InChI=1/C10H7Br/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Density: | 1.489 |
| Refractive index: | 1.656-1.659 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble in water |
| Appearance: | clear yellow liquid |
| Specification: |
The chemical synonyms of 1-Bromonaphthalene (90-11-9) are 1-Bromo-naphthalen ; 1-Naphthyl bromide ; 1-Naphthylbromide ; I-Bromnaphthalin ; Naphthalene,1-Bromo- ; α-Bromonaphthalene ; A-bromonaphthalene .As in any fire, wear a self-contained breathing apparatus in pressure-demand, MSHA/NIOSH (approved or equivalent), and full protective gear.Use water spray, dry chemical, carbon dioxide, or chemical foam. Wear chemical splash goggles to prevent eyes.Wear appropriate protective gloves to prevent skin exposure. Wear appropriate protective clothing to prevent skin exposure. It can be used as a raw material in organic synthesis, used as a refrigerant and solvent molecular weight substances, but also dry goods heat carrier. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Color: | slightly yellow to deep brownish-yellow |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
