| Identification | |
| Name: | 1-Chloronaphthalene |
| Synonyms: | 1-Naphthyl Chloride; A-CHLORONAPHTALENE; 1-Chloro naphthalene |
| CAS: | 90-13-1 |
| EINECS: | 201-967-3 |
| Molecular Formula: | C10H7Cl |
| Molecular Weight: | 162.62 |
| InChI: | InChI=1/C10H7Cl/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3082 |
| Density: | 1.194 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.631-1.633 |
| Water Solubility: | insoluble. |
| Appearance: | colourless oily liquid |
| Specification: |
1-Chloronaphthalene , its CAS NO. is 90-13-1, the synonyms are 1-Chlornaftalen ; 1-Chloro- ; alpha-Chloronaphthalene ; alpha-Chlornaphthalene ; 1-Naphthyl chloride ; .alpha.-Chloronaphthalene ; alpha-Naphthyl chloride xylamon ; Xilamon . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Color: | Oily liquid |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
N:Dangerousfortheenvironment
|
 |
|
