| Identification | |
| Name: | 1,2,3-Benzotriazin-4(3H)-one |
| Synonyms: | 3,4-Dihydro-4-oxo-1,2,3-benzotriazine;4-Ketobenz-1,2,3-triazine;Benzazimide;Benzazimidone;NSC 13563;NSC 20121;1,2,3-Benzotriazin-4(1H)-one(7CI,9CI); |
| CAS: | 90-16-4 |
| EINECS: | 201-971-5 |
| Molecular Formula: | C7H5N3O |
| Molecular Weight: | 147.13 |
| InChI: | InChI=1/C7H5N3O/c11-7-5-3-1-2-4-6(5)8-10-9-7/h1-4H,(H,8,9,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.47 g/cm3 |
| Refractive index: | 1.73 |
| Solubility: | Sol in alkaline soln and organic bases In water, 685 mg/L @ 25 deg C /Estimated/ |
| Appearance: | Buff Colored Powder |
| Specification: | Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| Color: | Tan powder Needles from cyclohexane |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
