| Identification | |
| Name: | 9-Acridinamine |
| Synonyms: | Acridine,9-amino- (8CI); 10-Amino-5-azaanthracene; 9-Aminoacridine; 9AA; Aminacrin;Aminacrine; Izoacridina; Monacrin; NSC 13000; NSC 28747 |
| CAS: | 90-45-9 |
| EINECS: | 201-995-6 |
| Molecular Formula: | C13H10 N2 |
| Molecular Weight: | 194.25 |
| InChI: | InChI=1/C13H10N2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H,(H2,14,15) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Melting Point: | 241 C |
| Density: | 1.268g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.78 |
| Water Solubility: | slight |
| Solubility: | slight |
| Appearance: | yellow crystals or powder |
| Specification: |
?9-Acridinamine (90-45-9) also can be called Aminoacridine , Acridin-9-amine ; 10-amino-9-azaanthracene and Aminacrine .It is a moderately strong base.It may be incompatible with isocyanates, peroxides, halogenated organics, phenols (acidic), anhydrides, epoxides, and acid halides.Neutralizes acids to form salts plus water in exothermic reactions.Flammable gaseous hydrogen is generated in combination with strong reducing agents, such as hydrides. |
| Report: |
EPA Genetic Toxicology Program. |
| Packinggroup: | III |
| Color: | PALE YELLOW CRYSTALS |
| Usage: | Acridine analog. DNA intercalating agent. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
