| Identification | |
| Name: | Xanthene, hydroxy- |
| Synonyms: | Xanthen-9-ol(6CI,7CI,8CI);9H-Xanthen-9-ol;9-Xanthydrol;NSC 4038;Xanthydrol; |
| CAS: | 90-46-0 |
| EINECS: | 201-996-1 |
| Molecular Formula: | C13H10O2 |
| Molecular Weight: | 198.2173 |
| InChI: | InChI=1S/C13H10O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8,13-14H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1230 |
| Density: | 1.286 g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.661 |
| Water Solubility: | Soluble in methanol: 0.1 g/mL |
| Solubility: | Soluble in methanol: 0.1 g/mL |
| Appearance: | White Crystals |
| Specification: | white powder usageEng:Intermediate in the preparation of Propantheline Bromide. Safety Statements:7-16-24-45-24/25-36-22 7:Keep container tightly closed 16:Keep away from sources of ignition - No smoking 24:Avoid contact with skin 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 22:Do not breathe dust |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | 2-8°C |
| Sensitive: | Light Sensitive |
| Usage: | Intermediate in the preparation of Propantheline Bromide. |
| Safety Data | |
| Hazard Symbols |
F: Flammable
T: Toxic
|
 |
|
