| Identification | |
| Name: | 2,5-Hexadienoic acid,3-methoxy-5-methyl-4-oxo- |
| Synonyms: | Penicillicacid (6CI); 3-Methoxy-5-methyl-4-oxo-2,5-hexadienoic acid; NSC 402844; g-keto-b-Methoxy-d-methylene-Da-hexenoicacid |
| CAS: | 90-65-3 |
| EINECS: | 202-008-1 |
| Molecular Formula: | C8H10 O4 |
| Molecular Weight: | 170.1626 |
| InChI: | InChI=1S/C8H10O4/c1-5(2)8(11)6(12-3)4-7(9)10/h4H,1H2,2-3H3,(H,9,10)/b6-4+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 1.157 g/cm3 |
| Water Solubility: | Soluble in DMSO, Ethanol, petrol ether. Not soluble in water |
| Solubility: | Soluble in DMSO, Ethanol, petrol ether. Not soluble in water |
| Appearance: | slight yellow powder |
| Specification: | white to light beige crystals or powder Safety Statements:37/39-26 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Packinggroup: | III |
| Storage Temperature: | Store at 2-8 |
| Color: | NEEDLES FROM PETROLEUM ETHER |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
T: Toxic
|
 |
|
