| Identification | |
| Name: | Benzenemethanol, a-[(1R)-1-(methylamino)ethyl]-, (aS)-rel- |
| Synonyms: | (R*,S*)-a-[1-(Methylamino)ethyl]benzenemethanol;Benzenemethanol, a-[1-(methylamino)ethyl]-, (R*,S*)-;DL-Ephedrine; |
| CAS: | 90-81-3 |
| EINECS: | 202-017-0 |
| Molecular Formula: | C10H15NO |
| Molecular Weight: | 165.26 |
| InChI: | InChI=1S/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3/t8-,10-/m0/s1 |
| Molecular Structure: | ![(C10H15NO) (R*,S*)-a-[1-(Methylamino)ethyl]benzenemethanol;Benzenemethanol, a-[1-(methylamino)ethyl]-, (R*,S*)-...](https://img1.guidechem.com/chem/e/dict/46/90-81-3.jpg) |
| Properties | |
| Density: | 1.015 g/cm3 |
| Refractive index: | 1.528 |
| Solubility: | 1 G DISSOLVES IN ABOUT 20 ML WATER, 0.2 ML ALC; SOL IN CHLOROFORM, ETHER, OILS Soluble in alcohol, ether, chloroform, and oils. Soluble in ethanol, benzene In water= 63,600 mg/L at 30 deg C |
| Report: |
Reported in EPA TSCA Inventory. |
| Color: | Waxy solid, crystals or granules White to colorless granules, pieces, or crystals Plates from water |
| Safety Data | |
 |
|
