| Identification | |
| Name: | Metaldehyde |
| Synonyms: | Antimilace;2,4,6,8-Tetramethyl-1,3,5,7-tetraoxacyclooctane or acetaldehyde homopolymer;Namekil;Acetaldehyde, polymers;Acetaldehyde, homopolymer;Limovet;Schnex-schneckentod;Polyacetaldehyde;Limax;Meta;Slugit;Terrasan-schneckentod gekoernt;Schneckokorn; |
| CAS: | 9002-91-9 |
| EINECS: | 200-836-8 |
| Molecular Formula: | (C2H4O)n |
| Molecular Weight: | 176.21024 |
| InChI: | InChI=1S/C8H16O4/c1-5-9-6(2)11-8(4)12-7(3)10-5/h5-8H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1332 |
| Melting Point: | 190-196 ºC |
| Flash Point: | °C |
| Boiling Point: | 18.6°Cat760mmHg |
| Density: | 0,808 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.385 |
| Water Solubility: | Soluble in benzene and chloroform; slightly soluble in diethyl ether and ethanol, insoluble in aceton and acetic acid |
| Solubility: | Soluble in benzene and chloroform; slightly soluble in diethyl ether and ethanol, insoluble in aceton and acetic acid |
| Appearance: | White needle-shaped crystalline |
| Specification: |
Polyacetaldehyde (CAS No.9002-91-9), it also can be called Acetaldehyde polymerized ; Acetaldehyde homopolymer ; 2,4,6,8-Tetramethyl-1,3,5,7-tetraoxacyclooctane ; Antimilace . It is white crystalline powder. |
| Packinggroup: | III |
| Flash Point: | °C |
| Storage Temperature: | 0-6°C |
| Color: | Crystalline powder Crystals |
| Usage: |
Polyacetaldehyde(9002-91-9) is a highly effective active ingredient to control slugs and snails (molluscicide). |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
