Identification |
Name: | Poly(oxy-1,2-ethanediyl),a-(1-oxohexadecyl)-w-hydroxy- |
Synonyms: | Glycols,polyethylene, monopalmitate (8CI); Palmitic acid, monoester with polyethyleneglycol (8CI); Atlas G 2076; Atlas G 2079; G 2079; Nissan Nonion P 6; Nonion P6; PEG-6 Palmitate; Poly(oxyethylene) monopalmitate; Polyethylene glycol esterof palmitic acid; Polyethylene glycol monopalmitate; Polyethylene glycolpalmitate; Polyethylene glycol palmitate ester; Polynon P 101; Polyoxyethyleneglycol monopalmitate; Polyoxyethylene palmitate; Polyoxyethylene-30 palmitate |
CAS: | 9004-94-8 |
Molecular Formula: | (C2H4 O)n C16 H32 O2 |
Molecular Weight: | 0 |
InChI: | InChI=1S/C18H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(20)21-17-16-19/h19H,2-17H2,1H3 |
Molecular Structure: |
![((C2H4O)nC16H32O2) Glycols,polyethylene, monopalmitate (8CI); Palmitic acid, monoester with polyethyleneglycol (8CI); A...](https://img1.guidechem.com/chem/e/dict/180/9004-94-8.jpg) |
Properties |
Flash Point: | 156°C |
Boiling Point: | 410.9°Cat760mmHg |
Density: | 0.919g/cm3 |
Flash Point: | 156°C |
Safety Data |
|
![](/images/detail_15.png) |