| Identification | |
| Name: | 1H-Cyclopenta[b]quinolin-9-amine,2,3,5,6,7,8-hexahydro-, hydrochloride (1:1) |
| Synonyms: | 1H-Cyclopenta[b]quinolin-9-amine,2,3,5,6,7,8-hexahydro-, monohydrochloride (9CI);9-Amino-2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinoline hydrochloride;Amiridin; Amiridine; Ipidacrine hydrochloride; NIK 247 |
| CAS: | 90043-86-0 |
| Molecular Formula: | C12H16 N2 . Cl H |
| Molecular Weight: | 242.78 |
| InChI: | InChI=1/C12H16N2.ClH/c13-12-8-4-1-2-6-10(8)14-11-7-3-5-9(11)12;/h1-7H2,(H2,13,14);1H |
| Molecular Structure: | ![(C12H16N2.ClH) 1H-Cyclopenta[b]quinolin-9-amine,2,3,5,6,7,8-hexahydro-, monohydrochloride (9CI);9-Amino-2,3,5,6,7,8...](https://img1.guidechem.com/chem/e/dict/33/90043-86-0.jpg) |
| Properties | |
| Flash Point: | 204°C |
| Boiling Point: | 368°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
9-Amino-2,3,5,6,7,8-hexahydro-1h-cyclopenta(b)quinoline hydrochloride hydrate (CAS NO.90043-86-0) is a toxic chemecal, flammable,thermal decomposition would release toxic nitrogen oxides and hydrogen chloride fumes,it chould be stored in low temperature, ventilation, drying environmental conditions,separated with food and raw materials, besides water, carbon oxides and oxidation of toxic carbon dioxide, dry powder, sand, water mist fire extinguishing agent can be used if emergency. |
| Flash Point: | 204°C |
| Safety Data | |
 |
|
